Product Details
4-Aminobutyric acid is utilized in both biochemical research and clinical medicine, particularly in treating conditions linked to hepatic coma and cerebrovascular disorders. As a pharmaceutical intermediate, it aids in lowering blood lipids, which makes it effective for the treatment and prevention of various forms of hepatic coma. Additionally, it can be used to treat poliomyelitis, cerebral hemorrhage, and as an antidote for gas poisoning. It also plays an important role in biochemical research and organic synthesis.
This compound works to reduce blood ammonia levels and promote brain metabolism, making it highly effective in treating hepatic coma, comas resulting from stroke sequelae, cerebral arteriosclerosis, head trauma sequelae, uremia, and gas poisoning. As a major inhibitory neurotransmitter in the brain, it acts as an agonist for GABAA and GABAB receptors, while also increasing chloride ion conductivity.
Product Application of 4-Aminobutyric Acid (CAS# 56-12-2)
4-Aminobutyric acid functions as a pharmaceutical intermediate with the capability to lower blood lipids, making it effective for the treatment and prevention of various types of hepatic coma. It can also be applied in the treatment of poliomyelitis and cerebral hemorrhage, as well as serving as an antidote for gas poisoning. Furthermore, it is widely used in biochemical research and organic synthesis.
This compound reduces blood ammonia levels and enhances brain metabolism, offering benefits in treating different types of hepatic coma and comas caused by stroke sequelae, cerebral arteriosclerosis, head trauma sequelae, uremia, and gas poisoning.
As a major inhibitory neurotransmitter in the brain, it acts as an agonist for GABAA and GABAB receptors, improving chloride (Cl−) conductivity.
1. Names and Identifiers
| Name | 4-Aminobutyric acid |
| CAS | No.56-12-2 |
| CID | 119 |
| EINECS(EC#) | 200-258-6 |
| Molecular Formula | C4H9NO2 (isomer) |
| Inchi | InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
| InChIkey | BTCSSZJGUNDROE-UHFFFAOYSA-N |
| Canonical Smiles | C(CC(=O)O)CN |
| Isomers Smiles | C(CC(=O)O)CN |
2.Properties
| Density | 1.2300 (estimate) |
| Melting point | 195?°C (dec.)(lit.) |
| Boiling point | 248oC at 760 mmHg |
| Refractive index | 1.4650 (estimate) |
| Flash Point | 103.8oC |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Precise Quality | 103.06300 |
| PSA | 63.32000 |
| logP | 0.51020 |
| Solubility | H2O: 1?M at?20?°C, clear, colorless |
| Appearance | H2O: 1?M at?20?°C, clear, colorless |
| Storage | Ambient temperatures. |
| Chemical Properties | White, powdery solid; savory, meat-like aroma |
| Color/Form | White to almost white |
| PKa | 4.031(at 25℃) |
| Water Solubility | H2O: 1?M at?20?°C, clear, colorless | SOLUBLE |
| Stability | Stable under normal temperatures and pressures. |
| StorageTemp | Store at RT. |
