Dibutyl phthalate is a colorless oily liquid with low solubility in water. Special attention needs to be paid to environmental safety in the whole handling process. In the event of leakage, the liquid can permeate soil effortlessly, causing potential pollution to groundwater and surrounding rivers.
The compound is combustible but not easy to ignite. Industrially, it is commonly applied in paint and plastic production. Moreover, it can be employed as a reaction medium for different types of chemical synthesis reactions. Effective containment measures are necessary to avoid its diffusion into the ecological environment.
| Dibutyl phthalate Chemical Properties |
| Melting point | -35 °C (lit.) |
| Boiling point | 340 °C (lit.) |
| density | 1.043 g/mL at 25 °C (lit.) |
| vapor density | 9.6 (vs air) |
| vapor pressure | 1 mm Hg ( 147 °C) |
| refractive index | n |
| Fp | 340 °F |
| storage temp. | 2-8°C |
| solubility | Very soluble in alcohol, ether, acetone, benzene |
| pka | 3.79 |
| form | Liquid |
| color | APHA: ≤10 |
| Specific Gravity | 1.049 (20/20℃) |
| Relative polarity | 0.272 |
| Odor | odorless |
| PH | 7 (20°C, 10mg/L) |
| explosive limit | 0.47%, 236°F |
| Water Solubility | Slightly soluble. 0.0013 g/100 mL |
| Thermal Conductivity | 0.132 W/(m·K) at 25 ℃ |
| FreezingPoint | -35℃ |
| Merck | 14,3035 |
| BRN | 1914064 |
| Henry's Law Constant | 6.3 x 10-5 atmm3/mol (quoted, Petrasek et al., 1983) |
| Exposure limits | NIOSH REL: TWA 5 mg/m3, IDLH 4,000 mg/m3; OSHA PEL: TWA 5 mg/m3; ACGIH TLV: TWA 5 mg/m3. |
| Dielectric constant | 6.0（45℃） |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE PLASTICISER SOLVENT |
| Cosmetic Ingredient Review (CIR) | Dibutyl phthalate (84-74-2) |
| InChI | 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| LogP | 4.46-4.57 at 20-30℃ |
| CAS DataBase Reference | 84-74-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Dibutyl phthalate(84-74-2) |
| EPA Substance Registry System | Dibutyl phthalate (84-74-2) |
| Safety Information |
| Hazard Codes | T,N,F |
| Risk Statements | 61-50-62-39/23/24/25-23/24/25-11 |
| Safety Statements | 53-45-61-36/37-16 |
| RIDADR | UN 3082 9/PG 3 |
| OEB | B |
| OEL | TWA: 5 mg/m3 |
| WGK Germany | 2 |
| RTECS | TI0875000 |
| Autoignition Temperature | 756 °F |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173100 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Repr. 1B |
| Hazardous Substances Data | 84-74-2(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for rats 8,000 mg/kg (RTECS, 1985). |
| IDLA | 4,000 mg/m3 |
